4-Iodo-2-nitroaniline
Catalog No: FT-0645992
CAS No: 20691-72-9
- Chemical Name: 4-Iodo-2-nitroaniline
- Molecular Formula: C6H5IN2O2
- Molecular Weight: 264.02
- InChI Key: QVCRSYXVWPPBFJ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5IN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 264.021 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 20691-72-9 |
| Bolling_Point: | 352.9±27.0 °C at 760 mmHg |
| Product_Name: | 4-Iodo-2-nitroaniline |
| Melting_Point: | 120-123ºC |
| Flash_Point: | 167.2±23.7 °C |
| MF: | C6H5IN2O2 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.19 |
| Flash_Point: | 167.2±23.7 °C |
| Melting_Point: | 120-123ºC |
| FW: | 264.021 |
| PSA: | 71.84000 |
| Exact_Mass: | 263.939575 |
| MF: | C6H5IN2O2 |
| Bolling_Point: | 352.9±27.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.726 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn:Harmful; |
| Risk_Statements(EU): | R22;R43 |
| Safety_Statements: | S36/37 |
| Symbol: | Warning |
| Warning_Statement: | P280 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921420090 |
| WGK_Germany: | 2 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)